C23H23F15O3 — CID 90823667
(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-hydroxynonyl) 4,5,5-trifluoro-2,2-dimethyl-4-phenylhexanoate (PubChem CID 90823667) has the molecular formula C23H23F15O3 and a molecular weight of 632.40 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-hydroxynonyl) 4,5,5-trifluoro-2,2-dimethyl-4-phenylhexanoate.
| Compound Name | (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-hydroxynonyl) 4,5,5-trifluoro-2,2-dimethyl-4-phenylhexanoate |
|---|---|
| PubChem CID | 90823667 |
| Molecular Formula | C23H23F15O3 |
| Molecular Weight | 632.40 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-hydroxynonyl) 4,5,5-trifluoro-2,2-dimethyl-4-phenylhexanoate |
| SMILES | CC(C)(CC(F)(c1ccccc1)C(C)(F)F)C(=O)OCCC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C23H23F15O3/c1-16(2,11-18(28,17(3,26)27)12-7-5-4-6-8-12)15(40)41-10-9-13(39)19(29,30)21(33,34)23(37,38)22(35,36)20(31,32)14(24)25/h4-8,13-14,39H,9-11H2,1-3H3 |
| InChIKey | XNVOMCIOILFRML-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.40 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|