C16H26N2O8 — CID 90824032
(2,5-dihydroxypyrrol-1-yl) 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoate (PubChem CID 90824032) has the molecular formula C16H26N2O8 and a molecular weight of 374.39 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 90824032 |
| Molecular Formula | C16H26N2O8 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H26N2O8/c1-16(2,3)25-15(22)17-7-9-24-11-10-23-8-6-14(21)26-18-12(19)4-5-13(18)20/h4-5,19-20H,6-11H2,1-3H3,(H,17,22) |
| InChIKey | KKTXRAQZXFFSMW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|