C41H46Si2 — CID 90824517
triethyl-[2-[15-(2-triethylsilylethynyl)-24-hexacyclo[11.11.1.01,10.04,9.014,19.021,25]pentacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenyl]ethynyl]silane (PubChem CID 90824517) has the molecular formula C41H46Si2 and a molecular weight of 594.99 g/mol. Its IUPAC name is triethyl-[2-[15-(2-triethylsilylethynyl)-24-hexacyclo[11.11.1.01,10.04,9.014,19.021,25]pentacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenyl]ethynyl]silane.
| Compound Name | triethyl-[2-[15-(2-triethylsilylethynyl)-24-hexacyclo[11.11.1.01,10.04,9.014,19.021,25]pentacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenyl]ethynyl]silane |
|---|---|
| PubChem CID | 90824517 |
| Molecular Formula | C41H46Si2 |
| Molecular Weight | 594.99 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | triethyl-[2-[15-(2-triethylsilylethynyl)-24-hexacyclo[11.11.1.01,10.04,9.014,19.021,25]pentacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenyl]ethynyl]silane |
| SMILES | CC[Si](C#CC1=CC=C2C=c3cccc(C#C[Si](CC)(CC)CC)c3=C3C=CC4=C5C=CC=CC5C=CC14C23)(CC)CC |
| InChI | InChI=1S/C41H46Si2/c1-7-42(8-2,9-3)28-25-32-17-15-18-33-30-34-20-21-35(26-29-43(10-4,11-5)12-6)41-27-24-31-16-13-14-19-36(31)38(41)23-22-37(39(32)33)40(34)41/h13-24,27,30-31,40H,7-12H2,1-6H3 |
| InChIKey | JJTONGDXTQCLIP-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.99 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|