C14H18F10O3 — CID 90824693
2-(fluoromethyl)-6-(1,1,3,3,3-pentafluoro-2-prop-2-enoxypropyl)-1,4-dioxane;1,1,1,2-tetrafluoropropane (PubChem CID 90824693) has the molecular formula C14H18F10O3 and a molecular weight of 424.28 g/mol. Its IUPAC name is 2-(fluoromethyl)-6-(1,1,3,3,3-pentafluoro-2-prop-2-enoxypropyl)-1,4-dioxane;1,1,1,2-tetrafluoropropane.
| Compound Name | 2-(fluoromethyl)-6-(1,1,3,3,3-pentafluoro-2-prop-2-enoxypropyl)-1,4-dioxane;1,1,1,2-tetrafluoropropane |
|---|---|
| PubChem CID | 90824693 |
| Molecular Formula | C14H18F10O3 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-(fluoromethyl)-6-(1,1,3,3,3-pentafluoro-2-prop-2-enoxypropyl)-1,4-dioxane;1,1,1,2-tetrafluoropropane |
| SMILES | C=CCOC(C(F)(F)F)C(F)(F)C1COCC(CF)O1.CC(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F6O3.C3H4F4/c1-2-3-19-9(11(15,16)17)10(13,14)8-6-18-5-7(4-12)20-8;1-2(4)3(5,6)7/h2,7-9H,1,3-6H2;2H,1H3 |
| InChIKey | XTQAIUPTCKIQMB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|