C10H20OS — CID 90824879
4-ethylsulfanyl-2,6-dimethylcyclohexan-1-ol (PubChem CID 90824879) has the molecular formula C10H20OS and a molecular weight of 188.34 g/mol. Its IUPAC name is 4-ethylsulfanyl-2,6-dimethylcyclohexan-1-ol.
| Compound Name | 4-ethylsulfanyl-2,6-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 90824879 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-ethylsulfanyl-2,6-dimethylcyclohexan-1-ol |
| SMILES | CCSC1CC(C)C(O)C(C)C1 |
| InChI | InChI=1S/C10H20OS/c1-4-12-9-5-7(2)10(11)8(3)6-9/h7-11H,4-6H2,1-3H3 |
| InChIKey | RPGCHSLUICHZSW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |