About 5-iminopent-2-enoic acid
5-iminopent-2-enoic acid (PubChem CID 90825285) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is 5-iminopent-2-enoic acid.
Molecular Properties
| Compound Name | 5-iminopent-2-enoic acid |
| PubChem CID | 90825285 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 5-iminopent-2-enoic acid |
| SMILES | [H]/N=C/CC=CC(=O)O |
| InChI | InChI=1S/C5H7NO2/c6-4-2-1-3-5(7)8/h1,3-4,6H,2H2,(H,7,8)/b3-1?,6-4+ |
| InChIKey | JSFDJVXDPRSMCV-WMBAVETBSA-N |
| XLogP | 0.67 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminopent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminopent-2-enoic acid?
The IUPAC name of 5-iminopent-2-enoic acid (CID 90825285) is 5-iminopent-2-enoic acid.
What is the SMILES notation for 5-iminopent-2-enoic acid?
The canonical SMILES for 5-iminopent-2-enoic acid is [H]/N=C/CC=CC(=O)O.
What is the InChIKey of 5-iminopent-2-enoic acid?
The InChIKey is JSFDJVXDPRSMCV-WMBAVETBSA-N. The full InChI is InChI=1S/C5H7NO2/c6-4-2-1-3-5(7)8/h1,3-4,6H,2H2,(H,7,8)/b3-1?,6-4+.
What are the key properties of 5-iminopent-2-enoic acid?
5-iminopent-2-enoic acid has a molecular weight of 113.12 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminopent-2-enoic acid is sourced from PubChem (CID 90825285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).