C17H22FN3O5S — CID 9082601
N-[(2S)-1-[2-[(3R)-1,1-dioxothiolane-3-carbonyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide (PubChem CID 9082601) has the molecular formula C17H22FN3O5S and a molecular weight of 399.44 g/mol. Its IUPAC name is N-[(2S)-1-[2-[(3R)-1,1-dioxothiolane-3-carbonyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-1-[2-[(3R)-1,1-dioxothiolane-3-carbonyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 9082601 |
| Molecular Formula | C17H22FN3O5S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[(2S)-1-[2-[(3R)-1,1-dioxothiolane-3-carbonyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(F)cc1)C(=O)NNC(=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22FN3O5S/c1-10(2)14(19-15(22)11-3-5-13(18)6-4-11)17(24)21-20-16(23)12-7-8-27(25,26)9-12/h3-6,10,12,14H,7-9H2,1-2H3,(H,19,22)(H,20,23)(H,21,24)/t12-,14-/m0/s1 |
| InChIKey | XXMHDTMROBGLBH-JSGCOSHPSA-N |
| XLogP | 0.16 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|