C18H22O6 — CID 90826132
[(3S,3aR,6R,6aR)-6-hexa-2,4-dienoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] hexa-2,4-dienoate (PubChem CID 90826132) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-6-hexa-2,4-dienoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] hexa-2,4-dienoate.
| Compound Name | [(3S,3aR,6R,6aR)-6-hexa-2,4-dienoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] hexa-2,4-dienoate |
|---|---|
| PubChem CID | 90826132 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(3S,3aR,6R,6aR)-6-hexa-2,4-dienoyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] hexa-2,4-dienoate |
| SMILES | CC=CC=CC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)C=CC=CC |
| InChI | InChI=1S/C18H22O6/c1-3-5-7-9-15(19)23-13-11-21-18-14(12-22-17(13)18)24-16(20)10-8-6-4-2/h3-10,13-14,17-18H,11-12H2,1-2H3/t13-,14+,17-,18-/m1/s1 |
| InChIKey | YFJPLXMOLWIGBU-LTCOOKNTSA-N |
| XLogP | 1.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|