C28H35F3N4O4 — CID 90826395
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)-1-hydroxyisoindol-2-yl]butyl]-2,2,2-trifluoroacetamide (PubChem CID 90826395) has the molecular formula C28H35F3N4O4 and a molecular weight of 548.61 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)-1-hydroxyisoindol-2-yl]butyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)-1-hydroxyisoindol-2-yl]butyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 90826395 |
| Molecular Formula | C28H35F3N4O4 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)-1-hydroxyisoindol-2-yl]butyl]-2,2,2-trifluoroacetamide |
| SMILES | CCN1CCN(c2cccc3c(O)n([C@H](CCCNC(=O)C(F)(F)F)c4ccc(OC)c(OC)c4)cc23)CC1 |
| InChI | InChI=1S/C28H35F3N4O4/c1-4-33-13-15-34(16-14-33)23-8-5-7-20-21(23)18-35(26(20)36)22(9-6-12-32-27(37)28(29,30)31)19-10-11-24(38-2)25(17-19)39-3/h5,7-8,10-11,17-18,22,36H,4,6,9,12-16H2,1-3H3,(H,32,37)/t22-/m1/s1 |
| InChIKey | FXPIGXZVTZZDEJ-JOCHJYFZSA-N |
| XLogP | 4.55 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|