About but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate
but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate (PubChem CID 90826399) has the molecular formula C17H22O8
and a molecular weight of 354.36 g/mol. Its IUPAC name is but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate.
Molecular Properties
| Compound Name | but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate |
| PubChem CID | 90826399 |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate |
| SMILES | C=CCC(=O)OC(=O)C(COC)(COC(=O)C(=C)C)OC(=O)CC=C |
| InChI | InChI=1S/C17H22O8/c1-6-8-13(18)24-16(21)17(10-22-5,25-14(19)9-7-2)11-23-15(20)12(3)4/h6-7H,1-3,8-11H2,4-5H3 |
| InChIKey | VNPKIOUBGYORRR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate?
The IUPAC name of but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate (CID 90826399) is but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate.
What is the SMILES notation for but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate?
The canonical SMILES for but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate is C=CCC(=O)OC(=O)C(COC)(COC(=O)C(=C)C)OC(=O)CC=C.
What is the InChIKey of but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate?
The InChIKey is VNPKIOUBGYORRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O8/c1-6-8-13(18)24-16(21)17(10-22-5,25-14(19)9-7-2)11-23-15(20)12(3)4/h6-7H,1-3,8-11H2,4-5H3.
What are the key properties of but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate?
but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate has a molecular weight of 354.36 g/mol, XLogP of 1.26, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enoyl 2-but-3-enoyloxy-2-(methoxymethyl)-3-(2-methylprop-2-enoyloxy)propanoate is sourced from PubChem (CID 90826399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).