C19H24N2O — CID 90827226
2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone (PubChem CID 90827226) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone.
| Compound Name | 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 90827226 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone |
| SMILES | CC1=C(C)Cc2ccccc2C1.CCn1ccnc1C(C)=O |
| InChI | InChI=1S/C12H14.C7H10N2O/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-3-9-5-4-8-7(9)6(2)10/h3-6H,7-8H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | WFVGVVRQAYLMJR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|