About 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone
2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone (PubChem CID 90827226) has the molecular formula C19H24N2O
and a molecular weight of 296.41 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone.
Molecular Properties
| Compound Name | 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone |
| PubChem CID | 90827226 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone |
| SMILES | CC1=C(C)Cc2ccccc2C1.CCn1ccnc1C(C)=O |
| InChI | InChI=1S/C12H14.C7H10N2O/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-3-9-5-4-8-7(9)6(2)10/h3-6H,7-8H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | WFVGVVRQAYLMJR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone?
The IUPAC name of 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone (CID 90827226) is 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone.
What is the SMILES notation for 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone?
The canonical SMILES for 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone is CC1=C(C)Cc2ccccc2C1.CCn1ccnc1C(C)=O.
What is the InChIKey of 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone?
The InChIKey is WFVGVVRQAYLMJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.C7H10N2O/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-3-9-5-4-8-7(9)6(2)10/h3-6H,7-8H2,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone?
2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone has a molecular weight of 296.41 g/mol, XLogP of 4.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1,4-dihydronaphthalene;1-(1-ethylimidazol-2-yl)ethanone is sourced from PubChem (CID 90827226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).