C9H7FN2O2 — CID 90827714
6-fluoro-7-methyl-3-nitroso-1,3-dihydroindol-2-one (PubChem CID 90827714) has the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. Its IUPAC name is 6-fluoro-7-methyl-3-nitroso-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-7-methyl-3-nitroso-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90827714 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 6-fluoro-7-methyl-3-nitroso-1,3-dihydroindol-2-one |
| SMILES | Cc1c(F)ccc2c1NC(=O)C2N=O |
| InChI | InChI=1S/C9H7FN2O2/c1-4-6(10)3-2-5-7(4)11-9(13)8(5)12-14/h2-3,8H,1H3,(H,11,13) |
| InChIKey | MNKYBNPQDBNEEL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |