C13H7F5O3 — CID 90828844
3-(2,3,4,5,6-pentafluorophenyl)-4-propan-2-yloxycyclobut-3-ene-1,2-dione (PubChem CID 90828844) has the molecular formula C13H7F5O3 and a molecular weight of 306.19 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenyl)-4-propan-2-yloxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenyl)-4-propan-2-yloxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 90828844 |
| Molecular Formula | C13H7F5O3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenyl)-4-propan-2-yloxycyclobut-3-ene-1,2-dione |
| SMILES | CC(C)Oc1c(-c2c(F)c(F)c(F)c(F)c2F)c(=O)c1=O |
| InChI | InChI=1S/C13H7F5O3/c1-3(2)21-13-5(11(19)12(13)20)4-6(14)8(16)10(18)9(17)7(4)15/h3H,1-2H3 |
| InChIKey | YKHQWQQGRCZALR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|