About 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide
3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide (PubChem CID 90829284) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide.
Molecular Properties
| Compound Name | 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide |
| PubChem CID | 90829284 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide |
| SMILES | NC(=O)C1=NN2C=CCC2C1 |
| InChI | InChI=1S/C7H9N3O/c8-7(11)6-4-5-2-1-3-10(5)9-6/h1,3,5H,2,4H2,(H2,8,11) |
| InChIKey | LPANSCIZSBNNNT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide?
The IUPAC name of 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide (CID 90829284) is 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide.
What is the SMILES notation for 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide?
The canonical SMILES for 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide is NC(=O)C1=NN2C=CCC2C1.
What is the InChIKey of 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide?
The InChIKey is LPANSCIZSBNNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c8-7(11)6-4-5-2-1-3-10(5)9-6/h1,3,5H,2,4H2,(H2,8,11).
What are the key properties of 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide?
3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide has a molecular weight of 151.17 g/mol, XLogP of -0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4-dihydro-3H-pyrrolo[1,2-b]pyrazole-2-carboxamide is sourced from PubChem (CID 90829284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).