About 3-methylspiro[4.5]deca-7,9-diene
3-methylspiro[4.5]deca-7,9-diene (PubChem CID 90829318) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 3-methylspiro[4.5]deca-7,9-diene.
Molecular Properties
| Compound Name | 3-methylspiro[4.5]deca-7,9-diene |
| PubChem CID | 90829318 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 3-methylspiro[4.5]deca-7,9-diene |
| SMILES | CC1CCC2(C=CC=CC2)C1 |
| InChI | InChI=1S/C11H16/c1-10-5-8-11(9-10)6-3-2-4-7-11/h2-4,6,10H,5,7-9H2,1H3 |
| InChIKey | XEHVXZKRIBUQBT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methylspiro[4.5]deca-7,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylspiro[4.5]deca-7,9-diene?
The IUPAC name of 3-methylspiro[4.5]deca-7,9-diene (CID 90829318) is 3-methylspiro[4.5]deca-7,9-diene.
What is the SMILES notation for 3-methylspiro[4.5]deca-7,9-diene?
The canonical SMILES for 3-methylspiro[4.5]deca-7,9-diene is CC1CCC2(C=CC=CC2)C1.
What is the InChIKey of 3-methylspiro[4.5]deca-7,9-diene?
The InChIKey is XEHVXZKRIBUQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-10-5-8-11(9-10)6-3-2-4-7-11/h2-4,6,10H,5,7-9H2,1H3.
What are the key properties of 3-methylspiro[4.5]deca-7,9-diene?
3-methylspiro[4.5]deca-7,9-diene has a molecular weight of 148.25 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylspiro[4.5]deca-7,9-diene is sourced from PubChem (CID 90829318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).