C29H37FN4O8 — CID 90829633
4-[ethyl(methyl)amino]-7-fluoro-10-hydroxy-9-[[2-(3-hydroxypyrrolidin-1-yl)acetyl]amino]-12a-methoxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90829633) has the molecular formula C29H37FN4O8 and a molecular weight of 588.63 g/mol. Its IUPAC name is 4-[ethyl(methyl)amino]-7-fluoro-10-hydroxy-9-[[2-(3-hydroxypyrrolidin-1-yl)acetyl]amino]-12a-methoxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | 4-[ethyl(methyl)amino]-7-fluoro-10-hydroxy-9-[[2-(3-hydroxypyrrolidin-1-yl)acetyl]amino]-12a-methoxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90829633 |
| Molecular Formula | C29H37FN4O8 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 4-[ethyl(methyl)amino]-7-fluoro-10-hydroxy-9-[[2-(3-hydroxypyrrolidin-1-yl)acetyl]amino]-12a-methoxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CCN(C)C1C(=O)C(C(N)=O)CC2(OC)C(=O)C3C(=O)c4c(O)c(NC(=O)CN5CCC(O)C5)cc(F)c4CC3CC12 |
| InChI | InChI=1S/C29H37FN4O8/c1-4-33(2)23-17-8-13-7-15-18(30)9-19(32-20(36)12-34-6-5-14(35)11-34)25(38)22(15)26(39)21(13)27(40)29(17,42-3)10-16(24(23)37)28(31)41/h9,13-14,16-17,21,23,35,38H,4-8,10-12H2,1-3H3,(H2,31,41)(H,32,36) |
| InChIKey | QCZNARDMHIDYNZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|