About 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid
2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid (PubChem CID 90829822) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid.
Molecular Properties
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid |
| PubChem CID | 90829822 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid |
| SMILES | CN(C)C(C(=O)O)C1=CCCC=C1 |
| InChI | InChI=1S/C10H15NO2/c1-11(2)9(10(12)13)8-6-4-3-5-7-8/h4,6-7,9H,3,5H2,1-2H3,(H,12,13) |
| InChIKey | FUNXQPTYTSUMTB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid?
The IUPAC name of 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid (CID 90829822) is 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid.
What is the SMILES notation for 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid?
The canonical SMILES for 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid is CN(C)C(C(=O)O)C1=CCCC=C1.
What is the InChIKey of 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid?
The InChIKey is FUNXQPTYTSUMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-11(2)9(10(12)13)8-6-4-3-5-7-8/h4,6-7,9H,3,5H2,1-2H3,(H,12,13).
What are the key properties of 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid?
2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid has a molecular weight of 181.23 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,5-dien-1-yl-2-(dimethylamino)acetic acid is sourced from PubChem (CID 90829822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).