C32H39F3N2O5S2 — CID 90830016
N-[5-tert-butyl-4-(6,6-dicyclopentyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide (PubChem CID 90830016) has the molecular formula C32H39F3N2O5S2 and a molecular weight of 652.80 g/mol. Its IUPAC name is N-[5-tert-butyl-4-(6,6-dicyclopentyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide.
| Compound Name | N-[5-tert-butyl-4-(6,6-dicyclopentyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 90830016 |
| Molecular Formula | C32H39F3N2O5S2 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | N-[5-tert-butyl-4-(6,6-dicyclopentyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide |
| SMILES | Cc1cc(SC2C(=O)CC(C3CCCC3)(C3CCCC3)OC2=O)c(C(C)(C)C)cc1NS(=O)(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C32H39F3N2O5S2/c1-19-15-26(43-28-25(38)17-31(42-29(28)39,20-9-5-6-10-20)21-11-7-8-12-21)23(30(2,3)4)16-24(19)37-44(40,41)27-14-13-22(18-36-27)32(33,34)35/h13-16,18,20-21,28,37H,5-12,17H2,1-4H3 |
| InChIKey | ITKKIXWOKUAELE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|