C28H33BrFNO5 — CID 90830067
1-O-tert-butyl 2-O-methyl (2R,5R)-2-(4-bromobut-2-enyl)-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 90830067) has the molecular formula C28H33BrFNO5 and a molecular weight of 562.48 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R,5R)-2-(4-bromobut-2-enyl)-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R,5R)-2-(4-bromobut-2-enyl)-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90830067 |
| Molecular Formula | C28H33BrFNO5 |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R,5R)-2-(4-bromobut-2-enyl)-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@]1(CC=CCBr)CC[C@H](c2ccc(OCc3ccccc3F)cc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33BrFNO5/c1-27(2,3)36-26(33)31-24(15-17-28(31,25(32)34-4)16-7-8-18-29)20-11-13-22(14-12-20)35-19-21-9-5-6-10-23(21)30/h5-14,24H,15-19H2,1-4H3/t24-,28+/m1/s1 |
| InChIKey | MBDBKWNJDQYXGU-YWEHKCAJSA-N |
| XLogP | 6.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|