C18H21NO5 — CID 90830516
16,18-dihydroxy-4-methyl-12-nitroso-3-oxabicyclo[12.4.0]octadeca-1(14),6,11,15,17-pentaen-2-one (PubChem CID 90830516) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 16,18-dihydroxy-4-methyl-12-nitroso-3-oxabicyclo[12.4.0]octadeca-1(14),6,11,15,17-pentaen-2-one.
| Compound Name | 16,18-dihydroxy-4-methyl-12-nitroso-3-oxabicyclo[12.4.0]octadeca-1(14),6,11,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 90830516 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 16,18-dihydroxy-4-methyl-12-nitroso-3-oxabicyclo[12.4.0]octadeca-1(14),6,11,15,17-pentaen-2-one |
| SMILES | CC1CC=CCCCC=C(N=O)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H21NO5/c1-12-7-5-3-2-4-6-8-14(19-23)9-13-10-15(20)11-16(21)17(13)18(22)24-12/h3,5,8,10-12,20-21H,2,4,6-7,9H2,1H3 |
| InChIKey | XQPBYWWUQJRJMC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|