About 4-ethynyl-3,5-dimethyl-2H-pyrrole
4-ethynyl-3,5-dimethyl-2H-pyrrole (PubChem CID 90830709) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 4-ethynyl-3,5-dimethyl-2H-pyrrole.
Molecular Properties
| Compound Name | 4-ethynyl-3,5-dimethyl-2H-pyrrole |
| PubChem CID | 90830709 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 4-ethynyl-3,5-dimethyl-2H-pyrrole |
| SMILES | C#CC1=C(C)CN=C1C |
| InChI | InChI=1S/C8H9N/c1-4-8-6(2)5-9-7(8)3/h1H,5H2,2-3H3 |
| InChIKey | XNVVLBKHOIPHQR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-3,5-dimethyl-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-3,5-dimethyl-2H-pyrrole?
The IUPAC name of 4-ethynyl-3,5-dimethyl-2H-pyrrole (CID 90830709) is 4-ethynyl-3,5-dimethyl-2H-pyrrole.
What is the SMILES notation for 4-ethynyl-3,5-dimethyl-2H-pyrrole?
The canonical SMILES for 4-ethynyl-3,5-dimethyl-2H-pyrrole is C#CC1=C(C)CN=C1C.
What is the InChIKey of 4-ethynyl-3,5-dimethyl-2H-pyrrole?
The InChIKey is XNVVLBKHOIPHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-4-8-6(2)5-9-7(8)3/h1H,5H2,2-3H3.
What are the key properties of 4-ethynyl-3,5-dimethyl-2H-pyrrole?
4-ethynyl-3,5-dimethyl-2H-pyrrole has a molecular weight of 119.17 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-3,5-dimethyl-2H-pyrrole is sourced from PubChem (CID 90830709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).