About tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate
tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate (PubChem CID 90830767) has the molecular formula C25H46N2O7
and a molecular weight of 486.65 g/mol. Its IUPAC name is tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate |
| PubChem CID | 90830767 |
| Molecular Formula | C25H46N2O7 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](N=C=O)C(=O)OC(C)(C)C.CCCCC[C@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO5.C11H23NO2/c1-13(2,3)19-11(17)8-7-10(15-9-16)12(18)20-14(4,5)6;1-5-6-7-8-9(12)10(13)14-11(2,3)4/h10H,7-8H2,1-6H3;9H,5-8,12H2,1-4H3/t10-;9-/m00/s1 |
| InChIKey | CRPLXOAKRXZGSN-CORIKADDSA-N |
| XLogP | 4.39 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate?
The IUPAC name of tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate (CID 90830767) is tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate.
What is the SMILES notation for tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate?
The canonical SMILES for tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate is CC(C)(C)OC(=O)CC[C@H](N=C=O)C(=O)OC(C)(C)C.CCCCC[C@H](N)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate?
The InChIKey is CRPLXOAKRXZGSN-CORIKADDSA-N. The full InChI is InChI=1S/C14H23NO5.C11H23NO2/c1-13(2,3)19-11(17)8-7-10(15-9-16)12(18)20-14(4,5)6;1-5-6-7-8-9(12)10(13)14-11(2,3)4/h10H,7-8H2,1-6H3;9H,5-8,12H2,1-4H3/t10-;9-/m00/s1.
What are the key properties of tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate?
tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate has a molecular weight of 486.65 g/mol, XLogP of 4.39, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-aminoheptanoate;ditert-butyl (2S)-2-isocyanatopentanedioate is sourced from PubChem (CID 90830767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).