About 8-ethyl-7-methylundeca-3,4,7-triene
8-ethyl-7-methylundeca-3,4,7-triene (PubChem CID 90830873) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is 8-ethyl-7-methylundeca-3,4,7-triene.
Molecular Properties
| Compound Name | 8-ethyl-7-methylundeca-3,4,7-triene |
| PubChem CID | 90830873 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 8-ethyl-7-methylundeca-3,4,7-triene |
| SMILES | CCC=C=CCC(C)=C(CC)CCC |
| InChI | InChI=1S/C14H24/c1-5-8-9-10-12-13(4)14(7-3)11-6-2/h8,10H,5-7,11-12H2,1-4H3 |
| InChIKey | XXCWSWCOYZMEMU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-7-methylundeca-3,4,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-7-methylundeca-3,4,7-triene?
The IUPAC name of 8-ethyl-7-methylundeca-3,4,7-triene (CID 90830873) is 8-ethyl-7-methylundeca-3,4,7-triene.
What is the SMILES notation for 8-ethyl-7-methylundeca-3,4,7-triene?
The canonical SMILES for 8-ethyl-7-methylundeca-3,4,7-triene is CCC=C=CCC(C)=C(CC)CCC.
What is the InChIKey of 8-ethyl-7-methylundeca-3,4,7-triene?
The InChIKey is XXCWSWCOYZMEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24/c1-5-8-9-10-12-13(4)14(7-3)11-6-2/h8,10H,5-7,11-12H2,1-4H3.
What are the key properties of 8-ethyl-7-methylundeca-3,4,7-triene?
8-ethyl-7-methylundeca-3,4,7-triene has a molecular weight of 192.35 g/mol, XLogP of 5.02, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-7-methylundeca-3,4,7-triene is sourced from PubChem (CID 90830873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).