About 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde
2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde (PubChem CID 90831357) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde |
| PubChem CID | 90831357 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde |
| SMILES | O=CCn1c(O)cc(S)c1O |
| InChI | InChI=1S/C6H7NO3S/c8-2-1-7-5(9)3-4(11)6(7)10/h2-3,9-11H,1H2 |
| InChIKey | GADGZZIVJRNOEX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde?
The IUPAC name of 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde (CID 90831357) is 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde.
What is the SMILES notation for 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde?
The canonical SMILES for 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde is O=CCn1c(O)cc(S)c1O.
What is the InChIKey of 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde?
The InChIKey is GADGZZIVJRNOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3S/c8-2-1-7-5(9)3-4(11)6(7)10/h2-3,9-11H,1H2.
What are the key properties of 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde?
2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde has a molecular weight of 173.19 g/mol, XLogP of 0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)acetaldehyde is sourced from PubChem (CID 90831357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).