C20H12F8N2O2S — CID 90831366
2-[3,5-bis(trifluoromethyl)phenyl]-N-[(3,5-difluoro-4-methylphenyl)-hydroxymethyl]-1,3-thiazole-5-carboxamide (PubChem CID 90831366) has the molecular formula C20H12F8N2O2S and a molecular weight of 496.38 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-[(3,5-difluoro-4-methylphenyl)-hydroxymethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[(3,5-difluoro-4-methylphenyl)-hydroxymethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90831366 |
| Molecular Formula | C20H12F8N2O2S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[(3,5-difluoro-4-methylphenyl)-hydroxymethyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1c(F)cc(C(O)NC(=O)c2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)s2)cc1F |
| InChI | InChI=1S/C20H12F8N2O2S/c1-8-13(21)4-9(5-14(8)22)16(31)30-17(32)15-7-29-18(33-15)10-2-11(19(23,24)25)6-12(3-10)20(26,27)28/h2-7,16,31H,1H3,(H,30,32) |
| InChIKey | NYRCIUSWKYNVFU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|