C17H23NO4 — CID 90831468
6-(3-cyclobut-2-en-1-yl-4-cyclopropyl-2,5-dihydroxypyrrol-1-yl)hexanoic acid (PubChem CID 90831468) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 6-(3-cyclobut-2-en-1-yl-4-cyclopropyl-2,5-dihydroxypyrrol-1-yl)hexanoic acid.
| Compound Name | 6-(3-cyclobut-2-en-1-yl-4-cyclopropyl-2,5-dihydroxypyrrol-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 90831468 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 6-(3-cyclobut-2-en-1-yl-4-cyclopropyl-2,5-dihydroxypyrrol-1-yl)hexanoic acid |
| SMILES | O=C(O)CCCCCn1c(O)c(C2C=CC2)c(C2CC2)c1O |
| InChI | InChI=1S/C17H23NO4/c19-13(20)7-2-1-3-10-18-16(21)14(11-5-4-6-11)15(17(18)22)12-8-9-12/h4-5,11-12,21-22H,1-3,6-10H2,(H,19,20) |
| InChIKey | MIXWCJIBYXLLCJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|