C24H27ClFN9O — CID 90831509
N-(3-chloro-5-methyl-4-pyrazolidin-4-ylphenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine (PubChem CID 90831509) has the molecular formula C24H27ClFN9O and a molecular weight of 511.99 g/mol. Its IUPAC name is N-(3-chloro-5-methyl-4-pyrazolidin-4-ylphenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine.
| Compound Name | N-(3-chloro-5-methyl-4-pyrazolidin-4-ylphenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 90831509 |
| Molecular Formula | C24H27ClFN9O |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | N-(3-chloro-5-methyl-4-pyrazolidin-4-ylphenyl)-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
| SMILES | Cc1cc(Nc2ccc(C/N=N/c3ncc(F)c(N4CCOCC4)n3)nc2)cc(Cl)c1C1CNNC1 |
| InChI | InChI=1S/C24H27ClFN9O/c1-15-8-19(9-20(25)22(15)16-10-29-30-11-16)32-18-3-2-17(27-12-18)13-31-34-24-28-14-21(26)23(33-24)35-4-6-36-7-5-35/h2-3,8-9,12,14,16,29-30,32H,4-7,10-11,13H2,1H3/b34-31+ |
| InChIKey | YYQOHVDZTNCGOD-WUVHBKSUSA-N |
| XLogP | 4.03 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|