About 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol
3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol (PubChem CID 90832239) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol |
| PubChem CID | 90832239 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol |
| SMILES | CC1CCCCC1O.COCC(C)C1CCC2OC2C1 |
| InChI | InChI=1S/C10H18O2.C7H14O/c1-7(6-11-2)8-3-4-9-10(5-8)12-9;1-6-4-2-3-5-7(6)8/h7-10H,3-6H2,1-2H3;6-8H,2-5H2,1H3 |
| InChIKey | VXVGXAPIQVOQEY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol?
The IUPAC name of 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol (CID 90832239) is 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol.
What is the SMILES notation for 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol?
The canonical SMILES for 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol is CC1CCCCC1O.COCC(C)C1CCC2OC2C1.
What is the InChIKey of 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol?
The InChIKey is VXVGXAPIQVOQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.C7H14O/c1-7(6-11-2)8-3-4-9-10(5-8)12-9;1-6-4-2-3-5-7(6)8/h7-10H,3-6H2,1-2H3;6-8H,2-5H2,1H3.
What are the key properties of 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol?
3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol has a molecular weight of 284.44 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methoxypropan-2-yl)-7-oxabicyclo[4.1.0]heptane;2-methylcyclohexan-1-ol is sourced from PubChem (CID 90832239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).