C24H35BN4O4 — CID 90832305
tert-butyl N-piperidin-3-yl-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,7-naphthyridin-4-yl]carbamate (PubChem CID 90832305) has the molecular formula C24H35BN4O4 and a molecular weight of 454.38 g/mol. Its IUPAC name is tert-butyl N-piperidin-3-yl-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,7-naphthyridin-4-yl]carbamate.
| Compound Name | tert-butyl N-piperidin-3-yl-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,7-naphthyridin-4-yl]carbamate |
|---|---|
| PubChem CID | 90832305 |
| Molecular Formula | C24H35BN4O4 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | tert-butyl N-piperidin-3-yl-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,7-naphthyridin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccnc2cnc(B3OC(C)(C)C(C)(C)O3)cc12)C1CCCNC1 |
| InChI | InChI=1S/C24H35BN4O4/c1-22(2,3)31-21(30)29(16-9-8-11-26-14-16)19-10-12-27-18-15-28-20(13-17(18)19)25-32-23(4,5)24(6,7)33-25/h10,12-13,15-16,26H,8-9,11,14H2,1-7H3 |
| InChIKey | TVMWUGRNWKCORU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|