C32H46N5O+3 — CID 90832422
trimethyl-[3-[[4-[(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylpyridin-1-ium-2-yl]-[3-(trimethylazaniumyl)propyl]amino]propyl]azanium (PubChem CID 90832422) has the molecular formula C32H46N5O+3 and a molecular weight of 516.75 g/mol. Its IUPAC name is trimethyl-[3-[[4-[(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylpyridin-1-ium-2-yl]-[3-(trimethylazaniumyl)propyl]amino]propyl]azanium.
| Compound Name | trimethyl-[3-[[4-[(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylpyridin-1-ium-2-yl]-[3-(trimethylazaniumyl)propyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 90832422 |
| Molecular Formula | C32H46N5O+3 |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | trimethyl-[3-[[4-[(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylpyridin-1-ium-2-yl]-[3-(trimethylazaniumyl)propyl]amino]propyl]azanium |
| SMILES | CN1C(=Cc2cc[n+](-c3ccccc3)c(N(CCC[N+](C)(C)C)CCC[N+](C)(C)C)c2)Oc2ccccc21 |
| InChI | InChI=1S/C32H46N5O/c1-33-29-17-11-12-18-30(29)38-32(33)26-27-19-22-35(28-15-9-8-10-16-28)31(25-27)34(20-13-23-36(2,3)4)21-14-24-37(5,6)7/h8-12,15-19,22,25-26H,13-14,20-21,23-24H2,1-7H3/q+3 |
| InChIKey | VTCOHNIHNYYLDH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|