About benzene;ethane;prop-1-en-2-yl N-butylcarbamate
benzene;ethane;prop-1-en-2-yl N-butylcarbamate (PubChem CID 90832720) has the molecular formula C16H27NO2
and a molecular weight of 265.40 g/mol. Its IUPAC name is benzene;ethane;prop-1-en-2-yl N-butylcarbamate.
Molecular Properties
| Compound Name | benzene;ethane;prop-1-en-2-yl N-butylcarbamate |
| PubChem CID | 90832720 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | benzene;ethane;prop-1-en-2-yl N-butylcarbamate |
| SMILES | C=C(C)OC(=O)NCCCC.CC.c1ccccc1 |
| InChI | InChI=1S/C8H15NO2.C6H6.C2H6/c1-4-5-6-9-8(10)11-7(2)3;1-2-4-6-5-3-1;1-2/h2,4-6H2,1,3H3,(H,9,10);1-6H;1-2H3 |
| InChIKey | DHYPYNLQHBLKHM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzene;ethane;prop-1-en-2-yl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethane;prop-1-en-2-yl N-butylcarbamate?
The IUPAC name of benzene;ethane;prop-1-en-2-yl N-butylcarbamate (CID 90832720) is benzene;ethane;prop-1-en-2-yl N-butylcarbamate.
What is the SMILES notation for benzene;ethane;prop-1-en-2-yl N-butylcarbamate?
The canonical SMILES for benzene;ethane;prop-1-en-2-yl N-butylcarbamate is C=C(C)OC(=O)NCCCC.CC.c1ccccc1.
What is the InChIKey of benzene;ethane;prop-1-en-2-yl N-butylcarbamate?
The InChIKey is DHYPYNLQHBLKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C6H6.C2H6/c1-4-5-6-9-8(10)11-7(2)3;1-2-4-6-5-3-1;1-2/h2,4-6H2,1,3H3,(H,9,10);1-6H;1-2H3.
What are the key properties of benzene;ethane;prop-1-en-2-yl N-butylcarbamate?
benzene;ethane;prop-1-en-2-yl N-butylcarbamate has a molecular weight of 265.40 g/mol, XLogP of 4.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethane;prop-1-en-2-yl N-butylcarbamate is sourced from PubChem (CID 90832720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).