C18H24F3N3O4S — CID 90832721
N-(piperidin-4-ylmethoxy)-1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90832721) has the molecular formula C18H24F3N3O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is N-(piperidin-4-ylmethoxy)-1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | N-(piperidin-4-ylmethoxy)-1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90832721 |
| Molecular Formula | C18H24F3N3O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-(piperidin-4-ylmethoxy)-1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)N1CC=C(NOCC2CCNCC2)CC1 |
| InChI | InChI=1S/C18H24F3N3O4S/c19-18(20,21)28-16-1-3-17(4-2-16)29(25,26)24-11-7-15(8-12-24)23-27-13-14-5-9-22-10-6-14/h1-4,7,14,22-23H,5-6,8-13H2 |
| InChIKey | RLYZQLUTWQSOFQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|