About N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide
N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide (PubChem CID 90833088) has the molecular formula C13H22BrNO4
and a molecular weight of 336.23 g/mol. Its IUPAC name is N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide |
| PubChem CID | 90833088 |
| Molecular Formula | C13H22BrNO4 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide |
| SMILES | CCC(CC)OC1C=C(Br)C(O)C(O)C1NC(C)=O |
| InChI | InChI=1S/C13H22BrNO4/c1-4-8(5-2)19-10-6-9(14)12(17)13(18)11(10)15-7(3)16/h6,8,10-13,17-18H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | JEZHENPINVVYJZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide?
The IUPAC name of N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide (CID 90833088) is N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide.
What is the SMILES notation for N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide?
The canonical SMILES for N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide is CCC(CC)OC1C=C(Br)C(O)C(O)C1NC(C)=O.
What is the InChIKey of N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide?
The InChIKey is JEZHENPINVVYJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22BrNO4/c1-4-8(5-2)19-10-6-9(14)12(17)13(18)11(10)15-7(3)16/h6,8,10-13,17-18H,4-5H2,1-3H3,(H,15,16).
What are the key properties of N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide?
N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide has a molecular weight of 336.23 g/mol, XLogP of 1.08, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-5,6-dihydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide is sourced from PubChem (CID 90833088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).