C20H34O2 — CID 90833254
oxolan-2-one;3,5,8-triethyltricyclo[5.2.1.02,6]decane (PubChem CID 90833254) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is oxolan-2-one;3,5,8-triethyltricyclo[5.2.1.02,6]decane.
| Compound Name | oxolan-2-one;3,5,8-triethyltricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 90833254 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | oxolan-2-one;3,5,8-triethyltricyclo[5.2.1.02,6]decane |
| SMILES | CCC1CC2CC1C1C(CC)CC(CC)C21.O=C1CCCO1 |
| InChI | InChI=1S/C16H28.C4H6O2/c1-4-10-7-13-9-14(10)16-12(6-3)8-11(5-2)15(13)16;5-4-2-1-3-6-4/h10-16H,4-9H2,1-3H3;1-3H2 |
| InChIKey | UZVKHJLEQZOBAW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |