About cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane
cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane (PubChem CID 90833364) has the molecular formula C14H26NOP
and a molecular weight of 255.34 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane.
Molecular Properties
| Compound Name | cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane |
| PubChem CID | 90833364 |
| Molecular Formula | C14H26NOP |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane |
| SMILES | CC(C)N=P(OC1=CC=CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H26NOP/c1-11(2)15-17(12(3)4,13(5)6)16-14-9-7-8-10-14/h7-9,11-13H,10H2,1-6H3 |
| InChIKey | YEDYSMXEWQGYLT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane?
The IUPAC name of cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane (CID 90833364) is cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane.
What is the SMILES notation for cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane?
The canonical SMILES for cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane is CC(C)N=P(OC1=CC=CC1)(C(C)C)C(C)C.
What is the InChIKey of cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane?
The InChIKey is YEDYSMXEWQGYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26NOP/c1-11(2)15-17(12(3)4,13(5)6)16-14-9-7-8-10-14/h7-9,11-13H,10H2,1-6H3.
What are the key properties of cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane?
cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane has a molecular weight of 255.34 g/mol, XLogP of 5.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-dien-1-yloxy-di(propan-2-yl)-propan-2-ylimino-λ5-phosphane is sourced from PubChem (CID 90833364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).