About 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide
2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide (PubChem CID 90833384) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide |
| PubChem CID | 90833384 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide |
| SMILES | CC1=CC(C)=C(C(N)C(N)=O)CC1 |
| InChI | InChI=1S/C10H16N2O/c1-6-3-4-8(7(2)5-6)9(11)10(12)13/h5,9H,3-4,11H2,1-2H3,(H2,12,13) |
| InChIKey | AERNSPPRFLOXOW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide?
The IUPAC name of 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide (CID 90833384) is 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide.
What is the SMILES notation for 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide?
The canonical SMILES for 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide is CC1=CC(C)=C(C(N)C(N)=O)CC1.
What is the InChIKey of 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide?
The InChIKey is AERNSPPRFLOXOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-6-3-4-8(7(2)5-6)9(11)10(12)13/h5,9H,3-4,11H2,1-2H3,(H2,12,13).
What are the key properties of 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide?
2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide has a molecular weight of 180.25 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(2,4-dimethylcyclohexa-1,3-dien-1-yl)acetamide is sourced from PubChem (CID 90833384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).