C16H26O2 — CID 90833988
2-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)methylidene]pentanoic acid (PubChem CID 90833988) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)methylidene]pentanoic acid.
| Compound Name | 2-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)methylidene]pentanoic acid |
|---|---|
| PubChem CID | 90833988 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)methylidene]pentanoic acid |
| SMILES | CCCC(=CC1C2(C)CCC(C2)C1(C)C)C(=O)O |
| InChI | InChI=1S/C16H26O2/c1-5-6-11(14(17)18)9-13-15(2,3)12-7-8-16(13,4)10-12/h9,12-13H,5-8,10H2,1-4H3,(H,17,18) |
| InChIKey | DRQLVQWQRPUYPY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|