About 5,7-dimethyl-4H-oxecine-3,9-dione
5,7-dimethyl-4H-oxecine-3,9-dione (PubChem CID 90834024) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 5,7-dimethyl-4H-oxecine-3,9-dione.
Molecular Properties
| Compound Name | 5,7-dimethyl-4H-oxecine-3,9-dione |
| PubChem CID | 90834024 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5,7-dimethyl-4H-oxecine-3,9-dione |
| SMILES | CC1=CC(=O)COCC(=O)CC(C)=C1 |
| InChI | InChI=1S/C11H14O3/c1-8-3-9(2)5-11(13)7-14-6-10(12)4-8/h3-4H,5-7H2,1-2H3 |
| InChIKey | UUOGEWDUGXZWCL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dimethyl-4H-oxecine-3,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-4H-oxecine-3,9-dione?
The IUPAC name of 5,7-dimethyl-4H-oxecine-3,9-dione (CID 90834024) is 5,7-dimethyl-4H-oxecine-3,9-dione.
What is the SMILES notation for 5,7-dimethyl-4H-oxecine-3,9-dione?
The canonical SMILES for 5,7-dimethyl-4H-oxecine-3,9-dione is CC1=CC(=O)COCC(=O)CC(C)=C1.
What is the InChIKey of 5,7-dimethyl-4H-oxecine-3,9-dione?
The InChIKey is UUOGEWDUGXZWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-8-3-9(2)5-11(13)7-14-6-10(12)4-8/h3-4H,5-7H2,1-2H3.
What are the key properties of 5,7-dimethyl-4H-oxecine-3,9-dione?
5,7-dimethyl-4H-oxecine-3,9-dione has a molecular weight of 194.23 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-4H-oxecine-3,9-dione is sourced from PubChem (CID 90834024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).