About [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate
[5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate (PubChem CID 90834485) has the molecular formula C18H13FN2O3
and a molecular weight of 324.31 g/mol. Its IUPAC name is [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate.
Molecular Properties
| Compound Name | [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate |
| PubChem CID | 90834485 |
| Molecular Formula | C18H13FN2O3 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate |
| SMILES | CC(=O)OC1(C2=CC=C2)OCCc2c1[nH]c1c(F)ccc(C#N)c21 |
| InChI | InChI=1S/C18H13FN2O3/c1-10(22)24-18(12-3-2-4-12)17-13(7-8-23-18)15-11(9-20)5-6-14(19)16(15)21-17/h2-6,21H,7-8H2,1H3 |
| InChIKey | WGPNAKJVKCNXSZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate?
The IUPAC name of [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate (CID 90834485) is [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate.
What is the SMILES notation for [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate?
The canonical SMILES for [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate is CC(=O)OC1(C2=CC=C2)OCCc2c1[nH]c1c(F)ccc(C#N)c21.
What is the InChIKey of [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate?
The InChIKey is WGPNAKJVKCNXSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN2O3/c1-10(22)24-18(12-3-2-4-12)17-13(7-8-23-18)15-11(9-20)5-6-14(19)16(15)21-17/h2-6,21H,7-8H2,1H3.
What are the key properties of [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate?
[5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate has a molecular weight of 324.31 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-cyano-1-(cyclobutadienyl)-8-fluoro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl] acetate is sourced from PubChem (CID 90834485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).