C26H38O6 — CID 90835673
7-(2,2-dimethyl-1,3-dioxolan-4-yl)-11-(hydroxymethyl)-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 90835673) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-11-(hydroxymethyl)-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-11-(hydroxymethyl)-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 90835673 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-11-(hydroxymethyl)-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1CCCC2CC=CC(CC=CC(=O)OC(C3COC(C)(C)O3)CC=CC(CO)C1)O2 |
| InChI | InChI=1S/C26H38O6/c1-19-8-4-10-21-11-6-12-22(30-21)13-7-15-25(28)31-23(14-5-9-20(16-19)17-27)24-18-29-26(2,3)32-24/h5-7,9,12,15,20-24,27H,1,4,8,10-11,13-14,16-18H2,2-3H3 |
| InChIKey | CGIRMPYHZOFPJP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|