C26H27F3N4O3 — CID 90835765
(2,2,2-trifluoroacetyl) 4-amino-8-[(4,5-diphenylpyrimidin-2-yl)amino]octanoate (PubChem CID 90835765) has the molecular formula C26H27F3N4O3 and a molecular weight of 500.52 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-amino-8-[(4,5-diphenylpyrimidin-2-yl)amino]octanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-amino-8-[(4,5-diphenylpyrimidin-2-yl)amino]octanoate |
|---|---|
| PubChem CID | 90835765 |
| Molecular Formula | C26H27F3N4O3 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-amino-8-[(4,5-diphenylpyrimidin-2-yl)amino]octanoate |
| SMILES | NC(CCCCNc1ncc(-c2ccccc2)c(-c2ccccc2)n1)CCC(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H27F3N4O3/c27-26(28,29)24(35)36-22(34)15-14-20(30)13-7-8-16-31-25-32-17-21(18-9-3-1-4-10-18)23(33-25)19-11-5-2-6-12-19/h1-6,9-12,17,20H,7-8,13-16,30H2,(H,31,32,33) |
| InChIKey | UFVHHOMEEKGVTI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|