C11H9F4N5O — CID 90835774
4-(3,4,4,4-tetrafluoro-2-methylidenebutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 90835774) has the molecular formula C11H9F4N5O and a molecular weight of 303.22 g/mol. Its IUPAC name is 4-(3,4,4,4-tetrafluoro-2-methylidenebutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 4-(3,4,4,4-tetrafluoro-2-methylidenebutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 90835774 |
| Molecular Formula | C11H9F4N5O |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-(3,4,4,4-tetrafluoro-2-methylidenebutoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | C=C(COc1cc(-n2cncn2)ncn1)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F4N5O/c1-7(10(12)11(13,14)15)3-21-9-2-8(17-5-18-9)20-6-16-4-19-20/h2,4-6,10H,1,3H2 |
| InChIKey | QRVLEGGGQRNDGP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|