C23H31NO3 — CID 90837763
[2-(3-butoxyphenyl)-1-phenylethyl] N-tert-butylcarbamate (PubChem CID 90837763) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is [2-(3-butoxyphenyl)-1-phenylethyl] N-tert-butylcarbamate.
| Compound Name | [2-(3-butoxyphenyl)-1-phenylethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90837763 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [2-(3-butoxyphenyl)-1-phenylethyl] N-tert-butylcarbamate |
| SMILES | CCCCOc1cccc(CC(OC(=O)NC(C)(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H31NO3/c1-5-6-15-26-20-14-10-11-18(16-20)17-21(19-12-8-7-9-13-19)27-22(25)24-23(2,3)4/h7-14,16,21H,5-6,15,17H2,1-4H3,(H,24,25) |
| InChIKey | DRKIXPSTVPMDNP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|