C17H28O4 — CID 90838261
[(2R,4aS,5S,8R,8aR)-8a-hydroxy-5-[(2S)-1-hydroxypropan-2-yl]-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 90838261) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(2R,4aS,5S,8R,8aR)-8a-hydroxy-5-[(2S)-1-hydroxypropan-2-yl]-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2R,4aS,5S,8R,8aR)-8a-hydroxy-5-[(2S)-1-hydroxypropan-2-yl]-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 90838261 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(2R,4aS,5S,8R,8aR)-8a-hydroxy-5-[(2S)-1-hydroxypropan-2-yl]-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(O)[C@H](C)CC[C@@H]([C@H](C)CO)[C@H]2C=C1C |
| InChI | InChI=1S/C17H28O4/c1-10-7-15-14(11(2)9-18)6-5-12(3)17(15,20)8-16(10)21-13(4)19/h7,11-12,14-16,18,20H,5-6,8-9H2,1-4H3/t11-,12-,14+,15-,16-,17-/m1/s1 |
| InChIKey | LECWZLYZSXPFEO-NJKIXHOVSA-N |
| XLogP | 2.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|