C30H42N2O5 — CID 90838783
[3-(4-methoxyphenyl)-1-[3-(2-methylphenyl)-3-pentoxyazetidin-1-yl]-1-oxopropan-2-yl] N-tert-butylcarbamate (PubChem CID 90838783) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1-[3-(2-methylphenyl)-3-pentoxyazetidin-1-yl]-1-oxopropan-2-yl] N-tert-butylcarbamate.
| Compound Name | [3-(4-methoxyphenyl)-1-[3-(2-methylphenyl)-3-pentoxyazetidin-1-yl]-1-oxopropan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90838783 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | [3-(4-methoxyphenyl)-1-[3-(2-methylphenyl)-3-pentoxyazetidin-1-yl]-1-oxopropan-2-yl] N-tert-butylcarbamate |
| SMILES | CCCCCOC1(c2ccccc2C)CN(C(=O)C(Cc2ccc(OC)cc2)OC(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C30H42N2O5/c1-7-8-11-18-36-30(25-13-10-9-12-22(25)2)20-32(21-30)27(33)26(37-28(34)31-29(3,4)5)19-23-14-16-24(35-6)17-15-23/h9-10,12-17,26H,7-8,11,18-21H2,1-6H3,(H,31,34) |
| InChIKey | UGOZYDSSWWXGRJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|