C13H20 — CID 90838888
1,3-dimethyl-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene (PubChem CID 90838888) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1,3-dimethyl-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene.
| Compound Name | 1,3-dimethyl-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene |
|---|---|
| PubChem CID | 90838888 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1,3-dimethyl-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[8]annulene |
| SMILES | CC1CC(C)C2CCCC=CC=C12 |
| InChI | InChI=1S/C13H20/c1-10-9-11(2)13-8-6-4-3-5-7-12(10)13/h3,5,7,10-11,13H,4,6,8-9H2,1-2H3 |
| InChIKey | VLPFWAMTSUVVSU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |