About [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol
[3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol (PubChem CID 90839426) has the molecular formula C21H24O3
and a molecular weight of 324.42 g/mol. Its IUPAC name is [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol.
Molecular Properties
| Compound Name | [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol |
| PubChem CID | 90839426 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol |
| SMILES | CC1C(C(O)O)C12CCc1ccc(OCCc3ccccc3)cc12 |
| InChI | InChI=1S/C21H24O3/c1-14-19(20(22)23)21(14)11-9-16-7-8-17(13-18(16)21)24-12-10-15-5-3-2-4-6-15/h2-8,13-14,19-20,22-23H,9-12H2,1H3 |
| InChIKey | UFQIAEPMFMKOIW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol?
The IUPAC name of [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol (CID 90839426) is [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol.
What is the SMILES notation for [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol?
The canonical SMILES for [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol is CC1C(C(O)O)C12CCc1ccc(OCCc3ccccc3)cc12.
What is the InChIKey of [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol?
The InChIKey is UFQIAEPMFMKOIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O3/c1-14-19(20(22)23)21(14)11-9-16-7-8-17(13-18(16)21)24-12-10-15-5-3-2-4-6-15/h2-8,13-14,19-20,22-23H,9-12H2,1H3.
What are the key properties of [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol?
[3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol has a molecular weight of 324.42 g/mol, XLogP of 3.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3'-methyl-5-(2-phenylethoxy)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methanediol is sourced from PubChem (CID 90839426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).