C27H25ClFN7O2 — CID 90839967
3-[4-[[4-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methyl-3-pyridinyl]amino]phenyl]phenol (PubChem CID 90839967) has the molecular formula C27H25ClFN7O2 and a molecular weight of 534.00 g/mol. Its IUPAC name is 3-[4-[[4-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methyl-3-pyridinyl]amino]phenyl]phenol.
| Compound Name | 3-[4-[[4-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methyl-3-pyridinyl]amino]phenyl]phenol |
|---|---|
| PubChem CID | 90839967 |
| Molecular Formula | C27H25ClFN7O2 |
| Molecular Weight | 534.00 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 3-[4-[[4-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methyl-3-pyridinyl]amino]phenyl]phenol |
| SMILES | Cc1nc(C/N=N/c2ncc(F)c(N3CCOCC3)n2)cc(Cl)c1Nc1ccc(-c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C27H25ClFN7O2/c1-17-25(33-20-7-5-18(6-8-20)19-3-2-4-22(37)13-19)23(28)14-21(32-17)15-31-35-27-30-16-24(29)26(34-27)36-9-11-38-12-10-36/h2-8,13-14,16,33,37H,9-12,15H2,1H3/b35-31+ |
| InChIKey | JTTXHXUPOHWLTR-JSLDZMDGSA-N |
| XLogP | 6.21 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|