C30H48Cl2O4S — CID 90840214
(2S,4aS,6aR,6bR,10S,12aR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid;thionyl dichloride (PubChem CID 90840214) has the molecular formula C30H48Cl2O4S and a molecular weight of 575.68 g/mol. Its IUPAC name is (2S,4aS,6aR,6bR,10S,12aR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid;thionyl dichloride.
| Compound Name | (2S,4aS,6aR,6bR,10S,12aR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid;thionyl dichloride |
|---|---|
| PubChem CID | 90840214 |
| Molecular Formula | C30H48Cl2O4S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | (2S,4aS,6aR,6bR,10S,12aR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid;thionyl dichloride |
| SMILES | CC1(C)C2CC[C@]3(C)C(CC=C4C5C[C@@](C)(C(=O)O)CC[C@]5(C)CC[C@@]43C)[C@@]2(C)CC[C@@H]1O.O=S(Cl)Cl |
| InChI | InChI=1S/C30H48O3.Cl2OS/c1-25(2)21-10-13-30(7)22(28(21,5)12-11-23(25)31)9-8-19-20-18-27(4,24(32)33)15-14-26(20,3)16-17-29(19,30)6;1-4(2)3/h8,20-23,31H,9-18H2,1-7H3,(H,32,33);/t20?,21?,22?,23-,26+,27-,28-,29-,30+;/m0./s1 |
| InChIKey | BGARVPPPSKKIFJ-BACCVYDQSA-N |
| XLogP | 8.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|