C34H37F2NO3 — CID 90840307
(5E)-5-(1,1-difluoroprop-2-enyl)-2-[4-(furan-3-yl)cyclohept-4-ene-1-carbonyl]-3,4-dimethyl-7-(5-methyl-1H-pyrrol-3-yl)-3,4,9,10-tetrahydro-2H-benzo[8]annulen-1-one (PubChem CID 90840307) has the molecular formula C34H37F2NO3 and a molecular weight of 545.67 g/mol. Its IUPAC name is (5E)-5-(1,1-difluoroprop-2-enyl)-2-[4-(furan-3-yl)cyclohept-4-ene-1-carbonyl]-3,4-dimethyl-7-(5-methyl-1H-pyrrol-3-yl)-3,4,9,10-tetrahydro-2H-benzo[8]annulen-1-one.
| Compound Name | (5E)-5-(1,1-difluoroprop-2-enyl)-2-[4-(furan-3-yl)cyclohept-4-ene-1-carbonyl]-3,4-dimethyl-7-(5-methyl-1H-pyrrol-3-yl)-3,4,9,10-tetrahydro-2H-benzo[8]annulen-1-one |
|---|---|
| PubChem CID | 90840307 |
| Molecular Formula | C34H37F2NO3 |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | (5E)-5-(1,1-difluoroprop-2-enyl)-2-[4-(furan-3-yl)cyclohept-4-ene-1-carbonyl]-3,4-dimethyl-7-(5-methyl-1H-pyrrol-3-yl)-3,4,9,10-tetrahydro-2H-benzo[8]annulen-1-one |
| SMILES | C=CC(F)(F)/C1=C/C(c2c[nH]c(C)c2)=CCCC2=C1C(C)C(C)C(C(=O)C1CCC=C(c3ccoc3)CC1)C2=O |
| InChI | InChI=1S/C34H37F2NO3/c1-5-34(35,36)29-17-25(27-16-20(2)37-18-27)10-7-11-28-30(29)21(3)22(4)31(33(28)39)32(38)24-9-6-8-23(12-13-24)26-14-15-40-19-26/h5,8,10,14-19,21-22,24,31,37H,1,6-7,9,11-13H2,2-4H3/b25-10?,29-17+ |
| InChIKey | WSKCULOQJCEDIW-YGQJHNLISA-N |
| XLogP | 8.45 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|